| Missing Links? Citation Matrix | Graphs | Glossary HistCite Guide About |
Nodes: 6632,
Authors: 8172,
Journals: 931,
Outer References: 172167,
Words: 8137
Collection span: 1921 - 2005
View: Overview. Sorted by LCS.
Page 20: 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
|---|---|---|---|---|---|
| 5701 | 2 | 11 | 5378 1997 COMPUTER PHYSICS COMMUNICATIONS 106 (1-2): 114-124 Flocke N SPINSGA: A program package for the evaluation of properties of spin-1/2 Heisenberg systems using the symmetric group approach | 0 | 3 |
| 5702 | 1 | 53 | 5379 1997 COMPUTERS & MATHEMATICS WITH APPLICATIONS 34 (5-6): 467-508 Gustafson K Operator spectral states | 0 | 6 |
| 5703 | 0 | 5 | 5380 1997 COMPUTERS IN PHYSICS 11 (1): 36-43 Karabach M; Muller G Introduction to the Bethe ansatz | 0 | 0 |
| 5704 | 4 | 57 | 5381 1997 CONTEMPORARY PHYSICS 38 (4): 257-268 Stenholm S; Wilkens M Jumps in quantum theory | 0 | 7 |
| 5705 | 2 | 55 | 5382 1997 ENDEAVOUR 21 (4): 154-158 Rouvray DH The treatment of uncertainty in the sciences | 0 | 1 |
| 5706 | 0 | 45 | 5383 1997 FORTSCHRITTE DER PHYSIK-PROGRESS OF PHYSICS 45 (6): 439-516 vanHolten JW Gravitational waves and black holes - An introduction to the physics of general relativity | 0 | 2 |
| 5707 | 2 | 16 | 5385 1997 FOUNDATIONS OF PHYSICS 27 (7): 1047-1060 VanIsacker P; Juillet O; Gjelsten BK A nuclear mass formula based on SU(4) symmetry | 0 | 4 |
| 5708 | 0 | 5 | 5387 1997 FUSION ENGINEERING AND DESIGN 34-5: 515-518 Cima G; Deng B; Domier CW; Geck WR; Hsia RP; et al. ECE imaging on TEXT-U | 0 | 0 |
| 5709 | 1 | 59 | 5388 1997 INORGANICA CHIMICA ACTA 259 (1-2): 329-338 Hash KR; Field RJ; Rosenberg E Studies on the mechanism of proton transfer in metal hydride clusters: Metal-to-ligand hydrogen transfer in Os-3(CO)(10)(CF3CN)(mu-H)H | 0 | 1 |
| 5710 | 5 | 75 | 5390 1997 INTERNATIONAL JOURNAL OF MODERN PHYSICS D 6 (1): 91-105 Pollock MD The Wheeler-DeWitt equation for the superstring world sheet | 0 | 0 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5711 | 3 | 29 | 5392 1997 INTERNATIONAL JOURNAL OF THEORETICAL PHYSICS 36 (11): 2371-2389 Gaioli FH; GarciaAlvarez ET; Castagnino MA The Gamow vectors and the Schwinger effect | 0 | 0 |
| 5712 | 4 | 28 | 5393 1997 INTERNATIONAL JOURNAL OF THEORETICAL PHYSICS 36 (11): 2409-2437 Wickramasekara S Interior symmetries of hadrons: SO(3,2) as a spectrum-generating group | 0 | 0 |
| 5713 | 2 | 83 | 5394 1997 INTERNATIONAL JOURNAL OF THEORETICAL PHYSICS 36 (12): 2759-2781 Sorkin RD Forks in the road, on the way to quantum gravity | 0 | 23 |
| 5714 | 2 | 131 | 5395 1997 ISIS 88 (3): 397-421 Nye MJ Aristocratic culture and the pursuit of science - The de Broglies in modern France | 0 | 0 |
| 5715 | 1 | 96 | 5396 1997 JOURNAL OF ANALYTICAL PSYCHOLOGY 42 (1): 47-80 Grotstein JS 'Internal objects' or 'chimerical monsters'? The demonic 'third forms' of the internal world | 0 | 0 |
| 5716 | 1 | 15 | 5397 1997 JOURNAL OF CHEMICAL EDUCATION 74 (2): 204-209 Klotz IM Captives of their fantasies: The German atomic bomb scientists | 0 | 0 |
| 5717 | 1 | 33 | 5403 1997 JOURNAL OF FUNCTIONAL ANALYSIS 144 (1): 117-152 Effros EG; Winkler S Matrix convexity: Operator analogues of the bipolar and Hahn-Banach theorems | 0 | 7 |
| 5718 | 2 | 11 | 5405 1997 JOURNAL OF MAGNETISM AND MAGNETIC MATERIALS 173 (3): 259-265 Kouzoudis D Heisenberg s=1/2 ring consisting of a prime number of atoms | 0 | 10 |
| 5719 | 4 | 30 | 5407 1997 JOURNAL OF MIND AND BEHAVIOR 18 (2-3): 127-154 Stapp HP The Copenhagen interpretation (Reprinted from American Journal of Physics, vol 40, 1098-1116, 1972) | 0 | 3 |
| 5720 | 2 | 48 | 5410 1997 JOURNAL OF PHYSICAL CHEMISTRY A 101 (50): 9749-9755 Tai S; Illinger KH; Papasavva S Infrared intensities, atomic charges, and dipole moments in the fluoroethane series using atomic polar tensor analysis | 0 | 6 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5721 | 2 | 19 | 5411 1997 JOURNAL OF PHYSICS A-MATHEMATICAL AND GENERAL 30 (3): 841-848 Tian GS A sufficient condition for two long-range orders coexisting in a lattice many-body system | 0 | 5 |
| 5722 | 4 | 489 | 5415 1997 JOURNAL OF PHYSICS G-NUCLEAR AND PARTICLE PHYSICS 23 (7): 731-789 Knowles IG; Lafferty GD Hadronization in Z(0) decay | 0 | 23 |
| 5723 | 1 | 16 | 5417 1997 JOURNAL OF PLASMA PHYSICS 57: 187-193 Chen SY; Kraichnan RH Inhibition of turbulent cascade by sweep | 0 | 7 |
| 5724 | 2 | 21 | 5418 1997 JOURNAL OF PLASMA PHYSICS 58: 247-257 Suchy K; Altman C Eigenmode scattering theorems for electromagnetic-acoustic fields in compressible magnetoplasmas with anisotropic pressure | 0 | 3 |
| 5725 | 4 | 10 | 5419 1997 JOURNAL OF RAMAN SPECTROSCOPY 28 (6): 381-381 Keifer W Resonance Raman scattering .A. - Foreword | 0 | 0 |
| 5726 | 9 | 34 | 5420 1997 JOURNAL OF RAMAN SPECTROSCOPY 28 (6): 427-431 Eichelsdorfer M; Engel V Inversion of potential energy curves from continuum resonance Raman scattering data with the help of a reflection principle | 0 | 1 |
| 5727 | 2 | 33 | 5424 1997 JOURNAL OF THE ATOMIC ENERGY SOCIETY OF JAPAN 39 (7): 546-557 Fukai Y A history of studies on neutron chain-reaction in Japan and the other countries during the World War II | 0 | 0 |
| 5728 | 3 | 36 | 5427 1997 MODERN PHYSICS LETTERS A 12 (27): 2029-2035 AmelinoCamelia G; Mavromatos NE; Ellis J; Nanopoulos DV On the space-time uncertainty relations of Liouville strings and D-branes | 0 | 14 |
| 5729 | 1 | 41 | 5428 1997 NUCLEAR PHYSICS B 492 (1-2): 455-471 Chandrasekharan S; Wiese UJ Quantum link models: A discrete approach to gauge theories | 0 | 24 |
| 5730 | 5 | 38 | 5430 1997 NUCLEAR PHYSICS B 499 (3): 519-546 Schroer B Wigner representation theory of the Poincare group, localization, statistics and the S-matrix | 0 | 9 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5731 | 1 | 30 | 5431 1997 NUOVO CIMENTO DELLA SOCIETA ITALIANA DI FISICA B-GENERAL PHYSICS RELATIVITY ASTRONOMY AND MATHEMATICAL PHYSICS AND METHODS 112 (4): 613-618 Wolf C Anomalous red-shifts due to a Dirac-like temporal variation of a discrete-time interval in quantum theory | 0 | 1 |
| 5732 | 1 | 36 | 5432 1997 NUOVO CIMENTO DELLA SOCIETA ITALIANA DI FISICA B-GENERAL PHYSICS RELATIVITY ASTRONOMY AND MATHEMATICAL PHYSICS AND METHODS 112 (12): 1637-1665 Borstnik NM; Fajfer S Spins and charges, the algebra and subalgebras of the group SO(1,14) and Grassmann space | 0 | 1 |
| 5733 | 1 | 16 | 5433 1997 PHILOSOPHICAL PSYCHOLOGY 10 (4): 481-488 Wu CQ Complementarity in vision and cognition | 0 | 0 |
| 5734 | 3 | 40 | 5434 1997 PHILOSOPHICAL TRANSACTIONS OF THE ROYAL SOCIETY OF LONDON SERIES A- MATHEMATICAL PHYSICAL AND ENGINEERING SCIENCES 355 (1733): 2279-2290 Barnett SM Quantum information via novel measurements | 0 | 2 |
| 5735 | 2 | 18 | 5437 1997 PHYSICA SCRIPTA 56 (4): 344-349 Healy WP Mass renormalization in low-energy photon scattering | 0 | 0 |
| 5736 | 4 | 18 | 5438 1997 PHYSICAL REVIEW A 55 (4): R2539-R2542 Kurtsiefer C; Dross O; Voigt D; Ekstrom CR; Pfau T; et al. Observation of correlated atom-photon pairs on the single-particle level | 0 | 9 |
| 5737 | 3 | 60 | 5439 1997 PHYSICAL REVIEW A 56 (1): 195-201 Freyberger M; Kienle SH; Yakovlev VP Interferometric measurement of an atomic wave function | 0 | 13 |
| 5738 | 1 | 22 | 5440 1997 PHYSICAL REVIEW A 56 (4): 2545-2548 Orlowski A Information entropy and squeezing of quantum fluctuations | 0 | 3 |
| 5739 | 1 | 22 | 5441 1997 PHYSICAL REVIEW A 56 (4): 2778-2783 Nesbet RK Local response model of the generalized polarization potential | 0 | 0 |
| 5740 | 2 | 24 | 5443 1997 PHYSICAL REVIEW A 56 (6): 4755-4763 Naus H; deLange A; Ubachs W b(1)Sigma(g)(+)-X-3 Sigma(g)(-) (0,0) band of oxygen isotopomers in relation to tests of the symmetrization postulate in O-16(2) | 0 | 17 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5741 | 2 | 93 | 5444 1997 PHYSICAL REVIEW A 56 (6): 5065-5099 Carmichael HJ Coherence and decoherence in the interaction of light with atoms | 0 | 19 |
| 5742 | 1 | 40 | 5449 1997 PHYSICAL REVIEW C 55 (1): 441-447 Benesh CJ; Goldman T Charge symmetry breaking in the valence quark distributions of the nucleon | 0 | 11 |
| 5743 | 5 | 129 | 5451 1997 PHYSICAL REVIEW D 55 (6): 3536-3551 Calzetta E; Hu BL Stochastic behavior of effective field theories across the threshold | 0 | 14 |
| 5744 | 3 | 35 | 5453 1997 PHYSICAL REVIEW D 55 (9): 5807-5812 Kovalevich SG; Osland P; Shnir YM; Tolkachev EA Effective Lagrangian of QED with a magnetic charge and dyon mass bounds | 0 | 3 |
| 5745 | 3 | 62 | 5455 1997 PHYSICAL REVIEW D 56 (3): 1455-1469 Kroger H; Scheu N Physics from Breit-frame regularization of a lattice Hamiltonian | 0 | 5 |
| 5746 | 5 | 25 | 5458 1997 PHYSICAL REVIEW LETTERS 78 (1): 1-4 Alexander FJ; Eyink GL Rayleigh-Ritz calculation of effective potential far from equilibrium | 0 | 8 |
| 5747 | 5 | 13 | 5462 1997 PHYSICS ESSAYS 10 (2): 315-326 Tschang Y Matrix mechanics and hadron statics | 0 | 2 |
| 5748 | 0 | 6 | 5463 1997 PHYSICS LETTERS A 228 (3): 134-140 Kuhlmann M Position measurements on quantum mechanical particles in bound states | 0 | 0 |
| 5749 | 1 | 16 | 5464 1997 PHYSICS LETTERS A 231 (1-2): 38-46 Vyatchanin SP; Lavrenov AY Heisenberg microscope and quantum variation measurement | 0 | 3 |
| 5750 | 7 | 192 | 5468 1997 PHYSICS OF PARTICLES AND NUCLEI 28 (6): 586-614 Pupyshev VV Low-energy expansions in nuclear physics | 0 | 3 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5751 | 1 | 19 | 5470 1997 PUBLIC HEALTH 111 (2): 67-69 Forster DP Uncertainties in medical audit | 0 | 0 |
| 5752 | 1 | 26 | 5471 1997 PURE AND APPLIED CHEMISTRY 69 (6): 1195-1202 Hizhnyakov V; Nevedrov D Hawking process in solids: Quantum generation of phonon bursts by a strongly excited mode | 0 | 2 |
| 5753 | 1 | 49 | 5473 1997 RADIATION PHYSICS AND CHEMISTRY 50 (1): 77-89 Manninen S Resonant Raman scattering and fluorescence spectroscopy | 0 | 6 |
| 5754 | 2 | 32 | 5475 1997 SCIENCE 278 (5343): 1609-1612 Wright WB; Budakian R; Pine DJ; Putterman SJ Imaging of intermittency in ripple-wave turbulence | 0 | 5 |
| 5755 | 5 | 69 | 5476 1997 SCIENCE IN CONTEXT 10 (1): 13-37 Beller M Criticism and revolutions | 0 | 2 |
| 5756 | 2 | 11 | 5477 1997 SOLID STATE COMMUNICATIONS 102 (1): 35-40 Xia K; Zhang WY; Zhai HR Magnetization and susceptibility of the two-spin Heisenberg model | 0 | 0 |
| 5757 | 1 | 42 | 5478 1997 THEOCHEM-JOURNAL OF MOLECULAR STRUCTURE 398: 145-153 Lin SK Understanding structural stability and process spontaneity based on the rejection of the Gibbs paradox of entropy of mixing | 0 | 0 |
| 5758 | 4 | 25 | 5479 1997 THEORETICAL AND COMPUTATIONAL FLUID DYNAMICS 9 (2): 103-119 Balakumar P Finite-amplitude equilibrium solutions for plane Poiseuille-Couette flow | 0 | 0 |
| 5759 | 5 | 178 | 5481 1997 USPEKHI FIZICHESKIKH NAUK 167 (3): 241-267 Borisov AV; Vshivtsev AS; Zhukovskii VC; Eminov PA Photons and leptons in external fields at finite temperature and density | 0 | 2 |
| 5760 | 2 | 14 | 5482 1997 ZEITSCHRIFT FUR NATURFORSCHUNG SECTION A-A JOURNAL OF PHYSICAL SCIENCES 52 (1-2): 49-52 Sussmann G Uncertainty relation: From inequality to equality | 0 | 0 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5761 | 1 | 29 | 5485 1997 ZEITSCHRIFT FUR PHYSIKALISCHE CHEMIE-INTERNATIONAL JOURNAL OF RESEARCH IN PHYSICAL CHEMISTRY & CHEMICAL PHYSICS 201: 301-315 Hizhnyakov V; Nevedrov D Nonlinear quantum dynamics of strong vibration: Relaxation jumps and phonon bursts | 0 | 1 |
| 5762 | 2 | 25 | 5486 1998 ACTA PHYSICA POLONICA B 29 (1-2): 157-166 Ormand WE Effects of the Coulomb interaction in nuclei: Binding energies and isospin mixing | 0 | 0 |
| 5763 | 1 | 27 | 5487 1998 ACTA PHYSICA SINICA-OVERSEAS EDITION 7 (5): 361-367 Zhang N; Ding WP; Tan XL; Xu YL; Xing DY; et al. Spin-dependent interfacial tunneling and magnetoresistance in the family of granular perovskite La1-xSrxMnO3 | 0 | 6 |
| 5764 | 3 | 57 | 5488 1998 ACTA PHYSICA SLOVACA 48 (1): 23-42 Joshi A; Vaccaro JA; Hill KE Number-phase Wigner representation and entropic uncertainty relations for binomial and negative binomial states | 0 | 4 |
| 5765 | 1 | 215 | 5489 1998 AMERICAN BIOLOGY TEACHER 60 (7): 510-517 Wayne R; Staves MP Connecting undergraduate plant cell biology students with the scientists about whom they learn: A bibliography | 0 | 0 |
| 5766 | 6 | 53 | 5490 1998 AMERICAN JOURNAL OF PHYSICS 66 (1): 27-33 Holladay WG The nature of particle-wave complementarity | 0 | 0 |
| 5767 | 3 | 9 | 5491 1998 AMERICAN JOURNAL OF PHYSICS 66 (4): 278-279 Cassidy DC Answer to Question #62. When did the indeterminacy principle become the uncertainty principle? | 0 | 0 |
| 5768 | 1 | 6 | 5493 1998 AMERICAN JOURNAL OF PHYSICS 66 (11): 970-972 Dotson AC Interpretive principles and the quantum mysteries | 0 | 1 |
| 5769 | 1 | 17 | 5495 1998 ANNALEN DER PHYSIK 7 (7-8): 737-747 Weingartner P Causality in the natural sciences | 0 | 0 |
| 5770 | 5 | 205 | 5496 1998 ANNALS OF SCIENCE 55 (2): 111-160 Forman P Molecular beam measurements of nuclear moments before magnetic resonance. Part I: I.I. Rabi and deflecting magnets to 1938 | 0 | 2 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5771 | 1 | 15 | 5497 1998 ANNALS OF THE INSTITUTE OF STATISTICAL MATHEMATICS 50 (4): 603-626 Matsunawa T Parametric statistical uncertainty relations and parametric statistical fundamental equations | 0 | 0 |
| 5772 | 6 | 58 | 5500 1998 BERICHTE DER BUNSEN-GESELLSCHAFT-PHYSICAL CHEMISTRY CHEMICAL PHYSICS 102 (12): 1857-1864 Peters G; Schramm B Nuclear spin state relaxation of formaldehyde in mixtures with inert gases | 0 | 5 |
| 5773 | 1 | 27 | 5501 1998 BOUNDARY-LAYER METEOROLOGY 86 (2): 279-312 Katul G; Chu CR A theoretical and experimental investigation of energy-containing scales in the dynamic sublayer of boundary-layer flows | 0 | 13 |
| 5774 | 0 | 9 | 5502 1998 CHAOS SOLITONS & FRACTALS 9 (7): 1183-1198 Zak M Non-Lipschitz approach to quantum mechanics | 0 | 2 |
| 5775 | 1 | 141 | 5503 1998 CHAOS SOLITONS & FRACTALS 9 (10): 1651-1701 Argyris J; Ciubotariu C; Andreadis I Complexity in spacetime and gravitation - I. From chaos to superchaos | 0 | 10 |
| 5776 | 2 | 20 | 5505 1998 CHEMICAL PHYSICS LETTERS 289 (3-4): 224-230 Andres H; Aebersold M; Gudel HU; Clemente JM; Coronado E; et al. Anisotropic exchange coupling in the Keggin derivative K-8[Co-2(D2O)(W11O39)]center dot nD(2)O | 0 | 12 |
| 5777 | 2 | 185 | 5509 1998 CHEMICAL REVIEWS 98 (4): 1335-1355 Schoonover JR; Strouse GF Time-resolved vibrational spectroscopy of electronically excited inorganic complexes in solution | 0 | 36 |
| 5778 | 5 | 75 | 5510 1998 CHEMISCHE TECHNIK 50 (3): 107-118 Mengel M; Winnewisser BP; Winnewisser M Research on para-and orthohydrogen: Spectroscopy on a molecular quantum crystal | 0 | 0 |
| 5779 | 14 | 118 | 5511 1998 CURRENT SCIENCE 74 (4): 328-340 Biswas N; Umapathy S Resonance Raman spectroscopy and ultrafast chemical dynamics | 0 | 5 |
| 5780 | 1 | 32 | 5512 1998 CURRENT SCIENCE 74 (12): 1112-1115 Singh R; Riess F Seventy years ago - The discovery of the Raman effect as seen from German physicists | 0 | 3 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5781 | 1 | 21 | 5513 1998 CZECHOSLOVAK JOURNAL OF PHYSICS 48 (9): 989-992 Wolf C Density perturbations due to the inhomogeneous discrete spatial structure of space-time | 0 | 0 |
| 5782 | 2 | 18 | 5514 1998 ENDEAVOUR 22 (2): 48-50 Stepansky BK Coming to terms with ambiguity in science - Case study of the historical aspect of wave-particle duality | 0 | 0 |
| 5783 | 0 | 10 | 5515 1998 ENVIRONMENTAL ETHICS 20 (3): 305-316 Drucker C Hannah Arendt on the need for a public debate oil science | 0 | 1 |
| 5784 | 3 | 40 | 5516 1998 EUROPEAN PHYSICAL JOURNAL D 1 (3): 317-327 Bosanac SD Semiclassical theory of Compton and photoelectric effects | 0 | 0 |
| 5785 | 2 | 16 | 5517 1998 EXTRAPOLATION 39 (1): 57-67 Dolis J Calvino's 'Cosmicomics': Original si(g)n | 0 | 0 |
| 5786 | 2 | 14 | 5518 1998 FORTSCHRITTE DER PHYSIK-PROGRESS OF PHYSICS 46 (6-8): 881-887 Kastner RE Time-symmetrized quantum theory and counterfactuals | 0 | 0 |
| 5787 | 0 | 22 | 5519 1998 FOUNDATIONS OF PHYSICS 28 (2): 167-184 Hushwater V A path from the quantization of the action variable to quantum mechanical formalism | 0 | 1 |
| 5788 | 1 | 21 | 5521 1998 FOUNDATIONS OF PHYSICS LETTERS 11 (4): 359-369 Hnizdo V Common misrepresentation of the Einstein-Podolsky-Rosen argument | 0 | 0 |
| 5789 | 8 | 157 | 5524 1998 INTERNATIONAL JOURNAL OF MODERN PHYSICS B 12 (7-8): 709-779 Shen SQ Strongly correlated electron systems: Spin-reflection positivity and some rigorous results | 0 | 21 |
| 5790 | 2 | 14 | 5527 1998 INTERNATIONAL JOURNAL OF MODERN PHYSICS E-NUCLEAR PHYSICS 7 (5): 559-571 Moshinsky M; Riquer V Nuclear physics methods for problems in relativistic quantum mechanics | 0 | 1 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5791 | 1 | 38 | 5530 1998 INTERNATIONAL JOURNAL OF THEORETICAL PHYSICS 37 (1): 291-304 Aerts D The hidden measurement formalism: What can be explained and where quantum paradoxes remain | 0 | 4 |
| 5792 | 3 | 22 | 5531 1998 INTERNATIONAL JOURNAL OF THEORETICAL PHYSICS 37 (1): 531-535 Antoci S; Liebscher DE Wentzel's path integrals | 0 | 0 |
| 5793 | 2 | 52 | 5534 1998 JOURNAL OF FLUID MECHANICS 363: 253-280 Luo XY; Pedley TJ The effects of wall inertia on flow in a two-dimensional collapsible channel | 0 | 14 |
| 5794 | 3 | 33 | 5535 1998 JOURNAL OF FLUID MECHANICS 363: 281-300 Nicodemus R; Grossmann S; Holthaus M The background flow method. Part 1. Constructive approach to bounds on energy dissipation | 0 | 22 |
| 5795 | 1 | 11 | 5537 1998 JOURNAL OF GENERAL INTERNAL MEDICINE 13 (1): 68-69 Stone DA; Rich JA In defense of qualitative research - Responses to the Poses and Isen perspectives article | 0 | 0 |
| 5796 | 2 | 58 | 5538 1998 JOURNAL OF HIGH ENERGY PHYSICS (4): Art. No. 008 Savvidy GK; Savvidy KG Gonihedric string equation I | 0 | 1 |
| 5797 | 2 | 20 | 5541 1998 JOURNAL OF MATHEMATICAL PHYSICS 39 (11): 5700-5715 Bodurov T Complex Hamiltonian evolution equations and field theory | 0 | 0 |
| 5798 | 2 | 28 | 5542 1998 JOURNAL OF MEMBRANE SCIENCE 148 (1): 45-57 Parvatiyar MG Mass transfer in a membrane tube with turbulent flow of Newtonian and non-Newtonian fluids | 0 | 5 |
| 5799 | 2 | 33 | 5543 1998 JOURNAL OF MODERN OPTICS 45 (1): 79-89 Duan LM; Guo GC Correlations in interference and diffraction | 0 | 0 |
| 5800 | 1 | 32 | 5545 1998 JOURNAL OF PHYSICAL CHEMISTRY A 102 (41): 8021-8026 Saito T; Ito A; Tanaka K Ab initio MO study of the cationic states of 1,3,5-triazine and hexahydro-1,3,5-triazine | 0 | 4 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5801 | 3 | 40 | 5548 1998 JOURNAL OF PHYSICS A-MATHEMATICAL AND GENERAL 31 (17): 3999-4011 Ashok B; Balakrishnan J Effective potential for phi(6) theory in three-dimensional curved spacetime | 0 | 0 |
| 5802 | 5 | 37 | 5549 1998 JOURNAL OF PHYSICS A-MATHEMATICAL AND GENERAL 31 (27): 5775-5786 Chruscinski D Canonical formalism for the Born-Infeld particle | 0 | 1 |
| 5803 | 1 | 26 | 5552 1998 JOURNAL OF PHYSICS A-MATHEMATICAL AND GENERAL 31 (43): 8727-8734 Zhdanov R; Panchak O New conditional symmetries and exact solutions of the nonlinear wave equation | 0 | 1 |
| 5804 | 5 | 46 | 5553 1998 JOURNAL OF PHYSICS G-NUCLEAR AND PARTICLE PHYSICS 24 (6): 1061-1076 do Amaral MG phi(6)(2) theory on the lattice - an effective potential study | 0 | 1 |
| 5805 | 2 | 22 | 5554 1998 JOURNAL OF PHYSICS-CONDENSED MATTER 10 (9): 2065-2079 Meyers C; Meurdesoif Y; Leroyer Y; Kahn O Anisotropy effects in a mixed quantum-classical Heisenberg model in two dimensions | 0 | 4 |
| 5806 | 1 | 19 | 5555 1998 JOURNAL OF PHYSICS-CONDENSED MATTER 10 (46): 10461-10474 Seeger A An analytical theory of the slowing down and the thermalization of positrons in condensed matter | 0 | 6 |
| 5807 | 2 | 34 | 5556 1998 JOURNAL OF PHYSICS-CONDENSED MATTER 10 (47): 10701-10713 Valladares RM; Fisher AJ; Blundell SJ; Hayes W Studies of implanted muons in organic radicals | 0 | 4 |
| 5808 | 0 | 16 | 5563 1998 LASER PHYSICS 8 (1): 142-149 Kotseroglou T; Bamber C; Berridge SC; Boege SJ; Bugg WM; et al. Studies of nonlinear QED in high energy electron-laser collisions | 0 | 0 |
| 5809 | 9 | 126 | 5564 1998 LASER PHYSICS 8 (2): 363-389 Klyshko DN Reduction of the wave function | 0 | 1 |
| 5810 | 2 | 70 | 5565 1998 MECCANICA 33 (5): 445-468 Barenblatt GI; Chorin AJ Turbulence: An old challenge and new perspectives | 0 | 2 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5811 | 1 | 63 | 5567 1998 MOLECULAR PHYSICS 95 (2): 319-329 Williamson DC The 'convex peg' model: the long range approximation | 0 | 6 |
| 5812 | 3 | 26 | 5568 1998 NUCLEAR PHYSICS A 629 (1-2): 37C-43C Akama K Nambu-Jona-Lasinio model at the next-to-leading order in 1/N | 0 | 3 |
| 5813 | 1 | 13 | 5569 1998 NUCLEAR PHYSICS A 629 (1-2): 475C-478C Shima T; Nagai Y; Kii T; Baba T; Takahashi T; et al. Precision test of charge symmetry of nuclear force via photonuclear reactions of He-4 | 0 | 0 |
| 5814 | 1 | 24 | 5570 1998 NUCLEAR PHYSICS A 638 (1-2): 35C-44C Nambu Y Symmetry breaking, chiral dynamics, and fermion masses | 0 | 2 |
| 5815 | 2 | 21 | 5571 1998 NUCLEAR PHYSICS B 530 (1-2): 487-500 Fosco CD; Schaposnik FA Virtual photon effects in D=3 Born-Infeld theory | 0 | 0 |
| 5816 | 3 | 15 | 5572 1998 OPTICS AND SPECTROSCOPY 85 (4): 497-503 Trukhanov SV; Gribov LA; Prokof'eva NI On a possibility of obtaining an expression for the Raman scattering tensor | 0 | 0 |
| 5817 | 1 | 68 | 5573 1998 OXIDES 155-1: 41-77 Deville A; Gaillard B ESR and NMR in non-conducting solids | 0 | 0 |
| 5818 | 0 | 10 | 5575 1998 PHYSICA A 260 (1-2): 186-200 Bernardes N Thermodynamics and complementarity | 0 | 1 |
| 5819 | 6 | 40 | 5576 1998 PHYSICA A-STATISTICAL MECHANICS AND ITS APPLICATIONS 256 (1-2): 178-196 Hofer WA Internal structures of electrons and photons: The concept of extended particles revisited | 0 | 1 |
| 5820 | 2 | 42 | 5577 1998 PHYSICA D 111 (1-4): 243-264 Jensen MH; Olesen P Turbulent binary fluids: A shell model study | 0 | 1 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5821 | 1 | 42 | 5579 1998 PHYSICAL REVIEW A 57 (1): 246-254 Kim YK; Migdalek J; Siegel W; Bieron J Electron-impact ionization cross section of rubidium | 0 | 5 |
| 5822 | 1 | 8 | 5582 1998 PHYSICAL REVIEW A 58 (1): 775-778 Girardeau MD Comment on "Particle-number-conserving Bogoliubov method which demonstrates the validity of the time-dependent Gross-Pitaevskii equation for a highly condensed Bose gas" | 0 | 25 |
| 5823 | 2 | 26 | 5583 1998 PHYSICAL REVIEW B 58 (13): 8579-8589 Metzke R; Nolting W Spin-filter effect of the europium chalcogenides: An exactly solved many-body model | 0 | 3 |
| 5824 | 5 | 12 | 5587 1998 PHYSICAL REVIEW D 5804 (4): art. no.-43005 Heyl JS; Hernquist L Electromagnetic shocks in strong magnetic fields | 0 | 2 |
| 5825 | 4 | 76 | 5588 1998 PHYSICAL REVIEW D 5811 (11): Art. No. 116002 Colladay D; Kostelecky VA Lorentz-violating extension of the standard model | 0 | 202 |
| 5826 | 1 | 10 | 5589 1998 PHYSICAL REVIEW LETTERS 80 (10): 2205-2208 Niu Q; Kleinman L Spin-wave dynamics in real crystals | 0 | 25 |
| 5827 | 2 | 25 | 5592 1998 PHYSICAL REVIEW LETTERS 81 (17): 3607-3610 Orihara H; Yun CC; Terakawa A; Itoh K; Yamamoto A; et al. Isospin mixing in the isobaric analog state derived from the (p, n (IAS)(p)over-tilde) reaction on Ce-140, (172),(174),Yb-176, and Pb-208 | 0 | 3 |
| 5828 | 1 | 47 | 5593 1998 PHYSICS ESSAYS 11 (1): 6-33 Jesudason CG On some difficulties concerning Heisenberg uncertainty and quantum mechanical relations | 0 | 0 |
| 5829 | 1 | 7 | 5595 1998 PHYSICS LETTERS A 248 (1): 16-18 Oganesyan SG Second harmonic generation in a polarized Dirac vacuum | 0 | 0 |
| 5830 | 1 | 19 | 5598 1998 PHYSICS LETTERS B 430 (1-2): 151-160 Isakov SB; Leinaas JM; Myrheim J; Polychronakos AP; Varnhagen R Algebra of observables for identical particles in one dimension | 0 | 4 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5831 | 2 | 47 | 5601 1998 PHYSICS LETTERS B 438 (1-2): 69-79 Savvidy GK Gonihedric string equation | 0 | 8 |
| 5832 | 2 | 28 | 5605 1998 PHYSICS OF ATOMIC NUCLEI 61 (11): 1885-1891 Dahm R Complex quaternions in spacetime symmetry and relativistic spin-flavor supermultiplets | 0 | 0 |
| 5833 | 0 | 18 | 5606 1998 PHYSICS OF FLUIDS 10 (9): 2228-2237 Balakumar P; Trivedi PA Finite amplitude stability of attachment line boundary layers | 0 | 1 |
| 5834 | 0 | 131 | 5607 1998 PROGRESS IN PHYSICAL GEOGRAPHY 22 (1): 61-78 Curran PJ; Atkinson PM Geostatistics and remote sensing | 0 | 28 |
| 5835 | 1 | 27 | 5609 1998 RADIOGRAPHICS 18 (2): 469-481 Schomer DF; Elekes AA; Hazle JD; Huffman JC; Thompson SK; et al. Introduction to wavelet-based compression of medical images | 0 | 17 |
| 5836 | 4 | 35 | 5610 1998 REVISTA MEXICANA DE FISICA 44 (4): 339-343 Camacho A; Dehnen H Higgs field and quantum theory | 0 | 0 |
| 5837 | 2 | 27 | 5611 1998 STUDIES IN APPLIED MATHEMATICS 101 (1): 1-21 Friedlander S; Howard L Instability in parallel flows revisited | 0 | 8 |
| 5838 | 2 | 104 | 5612 1998 STUDIES IN HISTORY AND PHILOSOPHY OF SCIENCE 29A (2): 273-298 Heelan PA The scope of hermeneutics in natural science | 0 | 4 |
| 5839 | 4 | 88 | 5614 1998 TRANSACTIONS OF THE INSTITUTE OF BRITISH GEOGRAPHERS 23 (4): 501-514 Harrison S; Dunham P Decoherence, quantum theory and their implications for the philosophy of geomorphology | 0 | 10 |
| 5840 | 6 | 21 | 5615 1998 USPEKHI FIZICHESKIKH NAUK 168 (6): 697-700 Feinberg EL The strange case of a great work | 0 | 0 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5841 | 1 | 8 | 5618 1998 ZEITSCHRIFT FUR NATURFORSCHUNG SECTION B-A JOURNAL OF CHEMICAL SCIENCES 53 (1): 58-62 Munch W; Walz L; Konig M Magnetic properties of [Cu{OCH2CH2N(C4H9)(2)}NCO](4) in the temperature range from 10 to 240 K | 0 | 0 |
| 5842 | 0 | 33 | 5619 1999 ACTA CRYSTALLOGRAPHICA SECTION A 55 (1): 246-257 Goodman P; Liu L X-ray multislice computation using the Moodie-Wagenfeld equations: divergent-beam pattern simulation in three-beam and six-beam Laue cases | 0 | 0 |
| 5843 | 2 | 54 | 5620 1999 ACTA MECHANICA 132 (1-4): 147-176 Gerard A; Uberall H; Guran A Generalized Debye series for acoustic scattering from objects of separable geometric shape | 0 | 1 |
| 5844 | 1 | 111 | 5621 1999 AMERICAN JOURNAL OF PHYSICS 67 (6): 476-485 Milonni PW Resource letter: AOA-1: Adaptive optics for astronomy | 0 | 2 |
| 5845 | 1 | 1 | 5622 1999 ANAESTHESIA 54 (5): 513-514 Williams M The Heisenberg uncertainty principle and anaesthetic performance | 0 | 0 |
| 5846 | 3 | 12 | 5624 1999 ASTRONOMY & ASTROPHYSICS SUPPLEMENT SERIES 138 (3): 513-514 Ruffini R The Dyadosphere of black holes and gamma-ray bursts | 0 | 5 |
| 5847 | 0 | 25 | 5626 1999 AUSTRALIAN JOURNAL OF PHYSICS 52 (3): 341-349 Briggs JS The dynamics of two-electron atoms | 0 | 0 |
| 5848 | 2 | 45 | 5627 1999 BOUNDARY-LAYER METEOROLOGY 92 (2): 263-291 Raymond WH Nonlocal turbulent mixing based on convective adjustment concepts (NTAC) | 0 | 5 |
| 5849 | 2 | 31 | 5628 1999 BRAZILIAN JOURNAL OF PHYSICS 29 (3): 574-578 Lopes JL Forty years of the first attempt at the electroweak unification and of the prediction of the weak neutral boson Z(0) | 0 | 0 |
| 5850 | 0 | 5 | 5630 1999 BRITISH JOURNAL FOR THE PHILOSOPHY OF SCIENCE 50 (4): 747-759 DiSalle R Philosophical concepts in physics: The historical relation between philosophy and scientific theories | 0 | 0 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5851 | 2 | 42 | 5633 1999 CLASSICAL AND QUANTUM GRAVITY 16 (12): 4057-4074 Dobado A; Maroto AL Non-local low-energy effective action for gravity with torsion | 0 | 2 |
| 5852 | 1 | 6 | 5634 1999 CLINICAL PSYCHOLOGY-SCIENCE AND PRACTICE 6 (1): 131-132 Shaw BF How to use the allegiance effect to maximize competence and therapeutic outcomes | 0 | 3 |
| 5853 | 4 | 97 | 5635 1999 COMPUTER PHYSICS COMMUNICATIONS 119 (1): 19-31 Chen RQ; Guo H The Chebyshev propagator for quantum systems | 0 | 26 |
| 5854 | 2 | 32 | 5636 1999 CONFIGURATIONS 7 (1): 43-60 Krips H Catachresis, quantum mechanics, and the letter of Lacan | 0 | 0 |
| 5855 | 1 | 16 | 5637 1999 CZECHOSLOVAK JOURNAL OF PHYSICS 49 (8): 1121-1135 Popov D Extension of the uncertainty relations to the mixed states | 0 | 3 |
| 5856 | 2 | 68 | 5638 1999 EARTH PLANETS AND SPACE 51 (7-8): 457-473 Fritts DC; Arendt S; Andreassen O The vorticity dynamics of instability and turbulence in a breaking internal gravity wave | 0 | 3 |
| 5857 | 6 | 39 | 5639 1999 EARTH PLANETS AND SPACE 51 (7-8): 515-524 Hall CM; Hoppe UP; Blix TA; Thrane EV; Manson AH; et al. Seasonal variation of turbulent energy dissipation rates in the polar mesosphere: a comparison of methods | 0 | 6 |
| 5858 | 2 | 22 | 5640 1999 EUROPEAN PHYSICAL JOURNAL A 4 (1): 33-39 Efros VD; Bang JM The first excited states of Be-9 and B-9 | 0 | 5 |
| 5859 | 7 | 60 | 5641 1999 EUROPEAN PHYSICAL JOURNAL B 7 (3): 467-482 Esser A; Grossmann S Nonperturbative renormalization group approach to turbulence | 0 | 1 |
| 5860 | 5 | 210 | 5643 1999 FOUNDATIONS OF PHYSICS 29 (1): 91-132 Mehra J; Rechenberg H Planck's half-quanta: A history of the concept of zero-point energy | 0 | 3 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5861 | 14 | 104 | 5644 1999 FOUNDATIONS OF PHYSICS 29 (2): 281-316 Meessen A Spacetime quantization, elementary particles, and cosmology | 0 | 0 |
| 5862 | 1 | 23 | 5645 1999 FOUNDATIONS OF PHYSICS LETTERS 12 (6): 533-545 Esposito S Photon wave mechanics: A de Broglie-Bohm approach | 0 | 2 |
| 5863 | 3 | 52 | 5646 1999 GENERAL RELATIVITY AND GRAVITATION 31 (2): 233-271 Hammond RT Spin gravity | 0 | 5 |
| 5864 | 0 | 54 | 5647 1999 GOETHE JAHRBUCH 116: 234-244 Muller I Goethe's theory of colour and morphology in 20th century natural sciences | 0 | 0 |
| 5865 | 1 | 18 | 5648 1999 HIGH TEMPERATURE 37 (2): 250-259 Alekseev BV; Mikhailov VV An investigation of vortex flows of compressible gas involving the use of generalized hydrodynamic equations | 0 | 0 |
| 5866 | 1 | 13 | 5649 1999 HIGH TEMPERATURE 37 (6): 865-872 Akatnov NI; Bystrova EN Calculations of some characteristics of homogeneous turbulence based on the Karman-Howarth equation closed by a semiempirical model | 0 | 0 |
| 5867 | 3 | 113 | 5650 1999 HISTORICAL STUDIES IN THE PHYSICAL AND BIOLOGICAL SCIENCES 29: 295-331 Kojevnikov A Freedom, collectivism, and quasiparticles: Social metaphors in quantum physics | 0 | 3 |
| 5868 | 1 | 24 | 5651 1999 IEEE TRANSACTIONS ON INFORMATION THEORY 45 (3): 1039-1042 Singer P Uncertainty inequalities for the continuous wavelet transform | 0 | 0 |
| 5869 | 1 | 9 | 5652 1999 INSIGHT 41 (5): 304-307 Lovejoy DJ Electric current waveforms for magnetic particle inspection | 0 | 0 |
| 5870 | 3 | 29 | 5654 1999 INTERNATIONAL JOURNAL OF MODERN PHYSICS A 14 (11): 1711-1719 Camacho A; Dehnen H Higgs field and localization problem | 0 | 0 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5871 | 3 | 14 | 5655 1999 INTERNATIONAL JOURNAL OF MODERN PHYSICS A 14 (14): 2285-2308 Pavel HP; Pervushin VN Reduced phase space quantization of massive vector theory | 0 | 6 |
| 5872 | 4 | 36 | 5656 1999 INTERNATIONAL JOURNAL OF MODERN PHYSICS A 14 (16): 2531-2535 Kuhne RW Gauge theory of gravity requires massive torsion field | 0 | 0 |
| 5873 | 2 | 21 | 5658 1999 INTERNATIONAL JOURNAL OF MODERN PHYSICS B 13 (20): 2629-2636 Orlov YF Complementary histories and collapse into the past in standard quantum mechanics | 0 | 0 |
| 5874 | 6 | 61 | 5660 1999 INTERNATIONAL JOURNAL OF MULTIPHASE FLOW 25 (4): 599-637 Steinkamp MJ; Clark TT; Harlow FH Two-point description of two-fluid turbulent mixing - I. Model formulation | 0 | 5 |
| 5875 | 2 | 33 | 5661 1999 INTERNATIONAL JOURNAL OF NON-LINEAR MECHANICS 34 (4): 589-602 Gupta GK Hydrodynamic stability of the plane Poiseuille flow of an electrorheological fluid | 0 | 2 |
| 5876 | 1 | 117 | 5665 1999 JOURNAL OF ANALYTICAL PSYCHOLOGY 44 (2): 197-220 Stephens BD The return of the prodigal: the emergence of Jungian themes in post-Freudian thought | 0 | 3 |
| 5877 | 0 | 18 | 5667 1999 JOURNAL OF EVALUATION IN CLINICAL PRACTICE 5 (1): 41-46 Needham CW Finding the ethical standard of medical science in the age of the sciences | 0 | 0 |
| 5878 | 1 | 23 | 5670 1999 JOURNAL OF MAGNETISM AND MAGNETIC MATERIALS 192 (1): 83-99 Wartewig P; Krause MK; Esquinazi P; Rosler S; Sonntag R Magnetic properties of Zn-and Ti-substituted barium hexaferrite | 0 | 20 |
| 5879 | 3 | 11 | 5671 1999 JOURNAL OF MAGNETISM AND MAGNETIC MATERIALS 195 (2): 501-507 Jiang Q; Jiang XF; Li ZY Effect of single-ion uniaxial anisotropy on the phase diagrams of magnetic system in the presence of internal spin fluctuation | 0 | 2 |
| 5880 | 1 | 49 | 5672 1999 JOURNAL OF MAMMALOGY 80 (2): 421-429 Jorgensen EE; Demarais S Spatial scale dependence of rodent habitat use | 0 | 8 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5881 | 1 | 22 | 5673 1999 JOURNAL OF MATERIALS SCIENCE 34 (8): 1829-1833 Zhang N; Ding WP; Zhong W; Xing DY; Du YW Interfacial tunnel-type GMR in granular perovskite La-Sr-Mn-O system | 0 | 4 |
| 5882 | 1 | 11 | 5674 1999 JOURNAL OF MATHEMATICAL CHEMISTRY 25 (4): 345-363 Iachello F; Del Sol Mesa A A class of exactly solvable matrix models | 0 | 1 |
| 5883 | 4 | 53 | 5677 1999 JOURNAL OF OPTICS B-QUANTUM AND SEMICLASSICAL OPTICS 1 (6): 668-677 Luis A; Sanchez-Soto LL Randomization of quantum relative phase in welcher Weg measurements | 0 | 6 |
| 5884 | 1 | 54 | 5678 1999 JOURNAL OF PHYSICS A-MATHEMATICAL AND GENERAL 32 (11): 2061-2074 Barkovsky LM; Furs AN Refractive index tensors in connection with problems of photon scattering | 0 | 4 |
| 5885 | 5 | 33 | 5679 1999 JOURNAL OF PHYSICS A-MATHEMATICAL AND GENERAL 32 (11): 2207-2216 Majernik V; Charvot R; Majernikova E The momentum entropy of the infinite potential well | 0 | 5 |
| 5886 | 3 | 49 | 5680 1999 JOURNAL OF PHYSICS A-MATHEMATICAL AND GENERAL 32 (22): 4111-4130 Hakioglu T Linear canonical transformations and quantum phase: a unified canonical and algebraic approach | 0 | 8 |
| 5887 | 2 | 20 | 5683 1999 JOURNAL OF PHYSICS A-MATHEMATICAL AND GENERAL 32 (26): 4921-4930 Brody DC; Meister BK Discrete uncertainty relations | 0 | 1 |
| 5888 | 2 | 35 | 5684 1999 JOURNAL OF PHYSICS B-ATOMIC MOLECULAR AND OPTICAL PHYSICS 32 (4): 973-986 Petrov ID; Sukhorukov VL; Hotop H The influence of core polarization on photo-ionization of alkali and metastable rare gas atoms near threshold | 0 | 9 |
| 5889 | 2 | 20 | 5685 1999 JOURNAL OF PHYSICS G-NUCLEAR AND PARTICLE PHYSICS 25 (4): 655-660 Iachello F Dynamic symmetries in nuclei | 0 | 1 |
| 5890 | 3 | 81 | 5686 1999 JOURNAL OF PHYSICS G-NUCLEAR AND PARTICLE PHYSICS 25 (9): 1859-1896 Bleicher M; Zabrodin E; Spieles C; Bass SA; Ernst C; et al. Relativistic hadron-hadron collisions in the ultra-relativistic quantum molecular dynamics model | 0 | 84 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5891 | 1 | 35 | 5687 1999 JOURNAL OF PHYSICS-CONDENSED MATTER 11 (12): L95-L103 Lai YZ; Hu ZN; Liang JQ; Pu FC The two-element spin chain related to the Heisenberg spin model | 0 | 0 |
| 5892 | 1 | 24 | 5688 1999 JOURNAL OF PHYSICS-CONDENSED MATTER 11 (12): 2625-2636 Zhang N; Wang F; Zhong W; Ding WP Spin-dependent interfacial tunnelling and tunnel-type GMR in granular perovskite family La1-xSrxMnO3 (0.05 <= x <= 0.45) | 0 | 13 |
| 5893 | 3 | 90 | 5689 1999 JOURNAL OF PHYSICS-CONDENSED MATTER 11 (42): R489-R528 Hedin L On correlation effects in electron spectroscopies and the GW approximation | 0 | 40 |
| 5894 | 1 | 32 | 5690 1999 JOURNAL OF STATISTICAL PHYSICS 94 (5-6): 859-869 Carati A; Galgani L On the specific heat of Fermi-Pasta-Ulam systems and their glassy behavior | 0 | 8 |
| 5895 | 3 | 9 | 5693 1999 MATHEMATICS AND COMPUTERS IN SIMULATION 49 (3): 221-234 Monagan MB; Ogilvie JF The diatomic anharmonic oscillator according to matrix mechanics | 0 | 0 |
| 5896 | 1 | 30 | 5694 1999 MICROELECTRONICS JOURNAL 30 (10): 925-934 Price PJ Quasi-bound states and resonances in heterostructures | 0 | 3 |
| 5897 | 1 | 20 | 5700 1999 NUCLEAR PHYSICS B 563 (1-2): 533-543 Fosco CD; Trinchero RC Domain walls and dimensional reduction | 0 | 0 |
| 5898 | 9 | 95 | 5701 1999 NUOVO CIMENTO DELLA SOCIETA ITALIANA DI FISICA A-NUCLEI PARTICLES AND FIELDS 112 (9): 977-1000 Kurilin AV Particle physics in intense electromagnetic fields | 0 | 1 |
| 5899 | 3 | 7 | 5702 1999 NUOVO CIMENTO DELLA SOCIETA ITALIANA DI FISICA B-GENERAL PHYSICS RELATIVITY ASTRONOMY AND MATHEMATICAL PHYSICS AND METHODS 114 (11): 1287-1303 Bose SK Schwinger's mechanism in QCD | 0 | 0 |
| 5900 | 1 | 21 | 5703 1999 OPTICS AND SPECTROSCOPY 87 (4): 532-540 Vyatchanin SP Quantum variation measurement and a Heisenberg microscope | 0 | 0 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5901 | 5 | 19 | 5704 1999 OPTICS COMMUNICATIONS 164 (1-3): 137-144 Moulin F; Bernard D Four-wave interaction in gas and vacuum: definition of a third-order nonlinear effective susceptibility in vacuum: chi((3))(vacuum) | 0 | 3 |
| 5902 | 1 | 24 | 5705 1999 PHYSICA A 264 (1-2): 171-179 Fulco UL; Lucena LS; Viswanathan GM Efficient search of critical points in Ising-like systems | 0 | 8 |
| 5903 | 2 | 19 | 5706 1999 PHYSICA A-STATISTICAL MECHANICS AND ITS APPLICATIONS 274 (3-4): 476-483 Shibata H Chaos viscosity and turbulent viscosity | 0 | 3 |
| 5904 | 0 | 27 | 5707 1999 PHYSICA C 318: 175-184 Hanke W; Eder R; Arrigoni E; Dorneich A; Zacher MG SO(5) theory of high-T-c superconductivity: models and experiments | 0 | 0 |
| 5905 | 1 | 18 | 5709 1999 PHYSICAL REVIEW A 59 (4): R2548-R2551 Main J; Wunner G Semiclassical calculation of transition matrix elements for atoms in external fields | 0 | 6 |
| 5906 | 2 | 34 | 5710 1999 PHYSICAL REVIEW A 59 (6): 4614-4622 Hasegawa Y; Badurek G Noncommuting spinor rotation due to balanced geometrical and dynamical phases | 0 | 1 |
| 5907 | 4 | 35 | 5711 1999 PHYSICAL REVIEW B 59 (4): 2676-2683 Bielinska-Waz D; Flocke N; Karwowski J Statistical properties of spectra of the Heisenberg Hamiltonian | 0 | 1 |
| 5908 | 2 | 81 | 5714 1999 PHYSICAL REVIEW B 59 (22): 14376-14383 Essler FHL Sine-Gordon low-energy effective theory for copper benzoate | 0 | 25 |
| 5909 | 2 | 33 | 5715 1999 PHYSICAL REVIEW C 6006 (6): art. no.-64310 Lisetskiy AF; Jolos RV; Pietralla N; von Brentano P Quasideuteron configurations in odd-odd N = Z nuclei | 0 | 18 |
| 5910 | 3 | 15 | 5716 1999 PHYSICAL REVIEW D 5901 (1): art. no.-13005 Dicus DA; Kao C; Repko WW gamma nu ->gamma gamma nu and crossed processes at energies below m(w) | 0 | 10 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5911 | 3 | 13 | 5717 1999 PHYSICAL REVIEW D 5904 (4): art. no.-45005 Heyl JS; Hernquist L Nonlinear QED effects in strong-field magnetohydrodynamics | 0 | 5 |
| 5912 | 6 | 34 | 5718 1999 PHYSICAL REVIEW D 5909 (9): Art. No. 094005 Schmidt S; Blaschke D; Ropke G; Prozorkevich AV; Smolyansky SA; et al. Non-Markovian effects in strong-field pair creation | 0 | 19 |
| 5913 | 1 | 58 | 5719 1999 PHYSICAL REVIEW D 5912 (12): Art. No. 123517 Pinto-Neto N; Santini ES Must quantum spacetimes be Euclidean? | 0 | 14 |
| 5914 | 4 | 57 | 5720 1999 PHYSICAL REVIEW D 6006 (6): Art. No. 065002 Dunne GV; Hall TM Borel summation of the derivative expansion and effective actions | 0 | 23 |
| 5915 | 6 | 37 | 5721 1999 PHYSICAL REVIEW D 6007 (7): Art. No. 075016 Ginzburg IF; Schiller A Visible effect of a very heavy magnetic monopole at colliders | 0 | 5 |
| 5916 | 3 | 80 | 5722 1999 PHYSICAL REVIEW D 6009 (9): art. no.-92004 Bamber C; Boege SJ; Koffas T; Kotseroglou T; Melissinos AC; et al. Studies of nonlinear QED in collisions of 46.6 GeV electrons with intense laser pulses | 0 | 18 |
| 5917 | 2 | 33 | 5723 1999 PHYSICAL REVIEW D 6010 (10): art. no.-104045 Dobado A; Maroto AL Particle production from nonlocal gravitational effective action | 0 | 3 |
| 5918 | 1 | 23 | 5725 1999 PHYSICAL REVIEW LETTERS 83 (23): 4721-4724 Moshammer R; Fainstein PD; Schulz M; Schmitt W; Kollmus H; et al. Initial state dependence of low-energy electron emission in fast ion atom collisions | 0 | 23 |
| 5919 | 7 | 26 | 5726 1999 PHYSICS LETTERS A 257 (1-2): 7-13 Dzhunushaliev V; Singleton D Einstein-Cartan-Heisenberg theory of gravity with dynamical torsion | 0 | 0 |
| 5920 | 5 | 239 | 5730 1999 PHYSICS OF PARTICLES AND NUCLEI 30 (3): 279-303 Lokhtin IP; Sarycheva LI; Snigirev AM Diagnostics of superdense matter in ultrarelativistic nuclear collisions | 0 | 8 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5921 | 6 | 363 | 5731 1999 PHYSICS REPORTS-REVIEW SECTION OF PHYSICS LETTERS 312 (3-6): 91-+ Gel'mukhanov F; Agren H Resonant X-ray Raman scattering | 0 | 2 |
| 5922 | 3 | 19 | 5732 1999 PHYSICS REPORTS-REVIEW SECTION OF PHYSICS LETTERS 320 (1-6): 37-49 Khriplovich IB Particle creation by charged black holes | 0 | 1 |
| 5923 | 1 | 47 | 5733 1999 PLASMA PHYSICS AND CONTROLLED FUSION 41 (8): 1025-1041 Volkov NB A model of two-temperature plasma with strong large-scale turbulence: dynamic equations, thermodynamics and transport coefficients | 0 | 2 |
| 5924 | 5 | 31 | 5734 1999 PRAMANA-JOURNAL OF PHYSICS 52 (4): 351-358 Sen D; Basu AN; Sengupta S Origin of mutual exclusiveness in Bohr's complementarity principle | 0 | 0 |
| 5925 | 4 | 36 | 5735 1999 PROCEEDINGS OF THE ROYAL SOCIETY OF LONDON SERIES A-MATHEMATICAL PHYSICAL AND ENGINEERING SCIENCES 455 (1984): 1521-1560 Jennings MJ; Stewart PA; Cowley SJ When is the weakly nonlinear evolution of a localized disturbance governed by the Ginzburg-Landau equation? | 0 | 2 |
| 5926 | 5 | 14 | 5738 1999 REVIEWS OF MODERN PHYSICS 71 (2): S1-S5 Bethe HA Quantum theory | 0 | 1 |
| 5927 | 2 | 53 | 5739 1999 REVIEWS OF MODERN PHYSICS 71 (2): S25-S32 Fitch VL Elementary particle physics: The origins | 0 | 0 |
| 5928 | 2 | 50 | 5740 1999 REVIEWS OF MODERN PHYSICS 71 (2): S288-S297 Zeilinger A Experiment and the foundations of quantum physics | 0 | 46 |
| 5929 | 7 | 134 | 5741 1999 REVIEWS OF MODERN PHYSICS 71 (2): S383-S395 Sreenivasan KR Fluid turbulence | 0 | 24 |
| 5930 | 0 | 104 | 5742 1999 SCIENCE EDUCATION 83 (4): 423-447 de Posada JM The presentation of metallic bonding in high school science textbooks during three decades: Science educational reforms and substantive changes of tendencies | 0 | 1 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5931 | 1 | 4 | 5743 1999 STUDIES IN APPLIED MATHEMATICS 103 (1): 43-50 Banerjee MB; Shandil RG; Gourla MG; Chauhan SS Eigenvalue bounds for the Orr-Sommerfeld equation and their relevance to the existence of backward wave motion | 0 | 2 |
| 5932 | 14 | 137 | 5744 1999 STUDIES IN HISTORY AND PHILOSOPHY OF MODERN PHYSICS 30B (4): 457-518 Lacki J; Ruegg H; Telegdi VL The road to Stueckelberg's covariant perturbation theory as illustrated by successive treatments of Compton scattering | 0 | 2 |
| 5933 | 3 | 82 | 5745 1999 STUDIES IN HISTORY AND PHILOSOPHY OF SCIENCE 30A (2): 303-333 Weinert F Theories, models and constraints | 0 | 0 |
| 5934 | 2 | 10 | 5746 1999 THEORETICAL AND MATHEMATICAL PHYSICS 120 (1): 876-882 Babanskii AY; Sitenko YA Vacuum energy induced by a singular magnetic vortex | 0 | 1 |
| 5935 | 7 | 47 | 5747 1999 THEORETICAL AND MATHEMATICAL PHYSICS 120 (3): 1150-1163 Novozhilov YV; Novozhilov VY Works of Vladimir Aleksandrovich Fock in quantum field theory (On the centennial of the birth of V. A. Fock) | 0 | 1 |
| 5936 | 2 | 21 | 5752 2000 ACTA PHYSICA SINICA 49 (6): 1031-1034 Li XZ; Yuan NY; Liu DJ; Hao JG Exterior gravitational perturbation on generalized Schwarzschild geometry | 0 | 3 |
| 5937 | 8 | 60 | 5753 2000 ADVANCES IN ATOMIC MOLECULAR, AND OPTICAL PHYSICS, VOL. 42 42: 29-71 Durr S; Rempe G Wave-particle duality in an atom interferometer | 0 | 2 |
| 5938 | 3 | 235 | 5754 2000 ADVANCES IN QUANTUM CHEMISTRY, VOL 38 38: 121-215 Ramasesha S; Pati SK; Shuai Z; Bredas JL The density matrix renormalization group method: Application to the low-lying electronic states in conjugated polymers | 0 | 4 |
| 5939 | 2 | 41 | 5756 2000 ANAIS DA ACADEMIA BRASILEIRA DE CIENCIAS 72 (3): 311-316 Lopes JL Unification of forces in physics: The first attempts | 0 | 0 |
| 5940 | 3 | 69 | 5758 2000 ANNALEN DER PHYSIK 9 (8): 589-604 Jaekel MT; Reynaud S Quantum hexaspherical observables for electrons | 0 | 1 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5941 | 3 | 23 | 5759 2000 ANNALEN DER PHYSIK 9 (8): 637-648 Shi Y Early Gedanken experiments of quantum mechanics revisited | 0 | 3 |
| 5942 | 4 | 59 | 5760 2000 ANNALEN DER PHYSIK 9 (11-12): 939-950 Cushing JT The interpretation of quantum mechanics through 1935 | 0 | 0 |
| 5943 | 3 | 38 | 5761 2000 ANNALEN DER PHYSIK 9 (11-12): 961-974 Kragh H Relativity and quantum theory from Sommerfeld to Dirac | 0 | 0 |
| 5944 | 0 | 48 | 5762 2000 ANNALEN DER PHYSIK 9 (11-12): 975-989 Stuewer RH The Compton effect: Transition to quantum mechanics | 0 | 0 |
| 5945 | 11 | 74 | 5764 2000 ARCHIVE FOR HISTORY OF EXACT SCIENCES 54 (4): 279-318 Lacki J The early axiomatizations of quantum mechanics: Jordan, Von Neumann and the continuation of Hilbert's program | 0 | 0 |
| 5946 | 4 | 63 | 5765 2000 ARCHIVE FOR HISTORY OF EXACT SCIENCES 55 (1): 43-56 Kragh H; Carazza B Classical behavior of macroscopic bodies from quantum principles: Early discussions | 0 | 0 |
| 5947 | 0 | 48 | 5766 2000 ARCHIVES DE PHILOSOPHIE 63 (4): 595-620 Bitbol M Relations, syntheses, backgrounds - Transcendental philosophy and modern physics | 0 | 0 |
| 5948 | 1 | 64 | 5768 2000 BIOTECHNOLOGY AND BIOENGINEERING 67 (6): 841-852 Croughan MS; Hamel JF; Wang DIC Hydrodynamic effects on animal cells grown in microcarrier cultures (Reprinted from Biotechnology and Bioengineering, vol 29, pg 130-141, 1987) | 0 | 0 |
| 5949 | 1 | 54 | 5769 2000 BRAZILIAN JOURNAL OF PHYSICS 30 (2): 330-345 Pinto-Neto N Quantum cosmology: How to interpret and obtain results | 0 | 0 |
| 5950 | 0 | 41 | 5770 2000 BRAZILIAN JOURNAL OF PHYSICS 30 (2): 357-361 Roditi I Integrable systems and quantum groups | 0 | 0 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5951 | 5 | 22 | 5771 2000 BRAZILIAN JOURNAL OF PHYSICS 30 (4): 649-653 Kobe S Ernst Ising 1900-1998 | 0 | 0 |
| 5952 | 1 | 27 | 5772 2000 BRITISH JOURNAL FOR THE PHILOSOPHY OF SCIENCE 51: 597-615 Bub J Indeterminacy and entanglement: The challenge of quantum mechanics | 0 | 1 |
| 5953 | 1 | 26 | 5773 2000 BULLETIN OF THE AMERICAN MATHEMATICAL SOCIETY 37 (2): 141-154 Morawetz CS Variations on conservation laws for the wave equation | 0 | 0 |
| 5954 | 2 | 58 | 5774 2000 CANADIAN JOURNAL OF PHYSICS 78 (10): 883-899 Antippa AF On the concept of kinetic energy | 0 | 1 |
| 5955 | 1 | 27 | 5775 2000 CHAOS 10 (4): 780-790 Laskin N Fractals and quantum mechanics | 0 | 0 |
| 5956 | 0 | 10 | 5776 2000 CHAOS SOLITONS & FRACTALS 11 (6): 987-997 El Naschie MS Heisenberg's critical mass calculations for an explosive nuclear reaction | 0 | 1 |
| 5957 | 1 | 28 | 5777 2000 CHAOS SOLITONS & FRACTALS 11 (7): 1149-1162 El Naschie MS On the unification of the fundamental forces and complex time in the epsilon((infinity)) space | 0 | 25 |
| 5958 | 3 | 15 | 5778 2000 CHEMICAL PHYSICS 253 (2-3): 361-366 Umek P; Omerzu A; Mihailovic D; Tokumoto M Synthesis and magnetic characterisation of fullerene derivative based ferromagnets 1-(3-nitro)- and 1-(3-aminophenyl)-1H-methanofullerene doped with cobaltocene | 0 | 2 |
| 5959 | 3 | 266 | 5781 2000 CHEMICAL REVIEWS 100 (2): 495-542 Rohmer MM; Benard M; Poblet JM Structure, reactivity, and growth pathways of metallocarbohedrenes M8C12 and transition metal/carbon clusters and nanocrystals: A challenge to computational chemistry | 0 | 70 |
| 5960 | 1 | 66 | 5783 2000 CHIRALITY 12 (4): 180-190 Abbate S; Longhi G; Santina C Theoretical and experimental studies for the interpretation of vibrational circular dichroism spectra in the CH-stretching overtone region | 0 | 6 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5961 | 6 | 50 | 5784 2000 COMMENTS ON MODERN PHYSICS 2 (4): D145-D156 Sadeghpour HR; Simbotin I Elastic and inelastic scattering of light | 0 | 0 |
| 5962 | 4 | 100 | 5785 2000 COORDINATION CHEMISTRY REVIEWS 198: 265-295 Nagao H; Nishino M; Shigeta Y; Soda T; Kitagawa Y; et al. Theoretical studies on effective spin interactions, spin alignments and macroscopic spin tunneling in polynuclear manganese and related complexes and their mesoscopic clusters | 0 | 13 |
| 5963 | 1 | 137 | 5788 2000 ECOLOGICAL MODELLING 132 (3): 231-246 Wilhelm T; Bruggemann R Goal functions for the development of natural systems | 0 | 4 |
| 5964 | 1 | 12 | 5789 2000 ESAIM-MATHEMATICAL MODELLING AND NUMERICAL ANALYSIS-MODELISATION MATHEMATIQUE ET ANALYSE NUMERIQUE 34 (2): 353-376 Foias C; Jolly MS; Manley OP Limiting behavior for an iterated viscosity | 0 | 0 |
| 5965 | 3 | 15 | 5793 2000 FOUNDATIONS OF PHYSICS 30 (3): 413-437 Holstein BR Evaluating the effective action | 0 | 0 |
| 5966 | 8 | 76 | 5794 2000 FOUNDATIONS OF PHYSICS 30 (4): 543-565 Gamberg L; Kalbfleisch GR; Milton KA Direct and indirect searches for low-mass magnetic monopoles | 0 | 6 |
| 5967 | 0 | 36 | 5795 2000 HISTORICAL STUDIES IN THE PHYSICAL AND BIOLOGICAL SCIENCES 31: 37-53 Crawford E German scientists and Hitler's vendetta against the Nobel prizes | 0 | 1 |
| 5968 | 1 | 16 | 5797 2000 INDIAN JOURNAL OF ENGINEERING AND MATERIALS SCIENCES 7 (1): 8-15 Roychowdhury AP; Sreedhar BN Viscous linear stability analysis of non-homentropic, compressible mixing layers | 0 | 0 |
| 5969 | 5 | 53 | 5798 2000 INFINITE DIMENSIONAL ANALYSIS QUANTUM PROBABILITY AND RELATED TOPICS 3 (4): 577-610 Belavkin VP Quantum probabilities and paradoxes of the quantum century | 0 | 0 |
| 5970 | 1 | 10 | 5799 2000 INTERNATIONAL JOURNAL OF MODERN PHYSICS A 15 (1): 105-131 Boos HE Quantum model of interacting "strings" on the square lattice | 0 | 0 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5971 | 2 | 34 | 5800 2000 INTERNATIONAL JOURNAL OF MODERN PHYSICS A 15 (6): 875-892 Wignall JWG How many fundamental constants does quantum physics need? | 0 | 2 |
| 5972 | 3 | 108 | 5801 2000 INTERNATIONAL JOURNAL OF MODERN PHYSICS A 15 (13): 1869-2017 Faraggi AE; Matone M The equivalence postulate of quantum mechanics | 0 | 20 |
| 5973 | 1 | 6 | 5802 2000 INTERNATIONAL JOURNAL OF MODERN PHYSICS A 15 (15): 2255-2268 Novello M; Arcuri RC Dynamical boson field in the nonlinear spinor theory | 0 | 0 |
| 5974 | 6 | 52 | 5804 2000 INTERNATIONAL JOURNAL OF THEORETICAL PHYSICS 39 (9): 2231-2252 Appleby DM Optimal measurements of spin direction | 0 | 1 |
| 5975 | 1 | 10 | 5806 2000 JOURNAL OF APPLIED PHYSICS 88 (7): 4265-4268 Feickert CA; Berman J; Kamphaus J; Trovillion J; Quattrone R A semiquantitative analytic model for the magnetic response of a Terfenol-D impregnated composite specimen under tension | 0 | 1 |
| 5976 | 1 | 4 | 5807 2000 JOURNAL OF CHEMICAL EDUCATION 77 (8): 1025-1027 Muino PL Introducing the uncertainty principle using diffraction of light waves | 0 | 0 |
| 5977 | 1 | 75 | 5809 2000 JOURNAL OF ELECTRON SPECTROSCOPY AND RELATED PHENOMENA 110 (1-3): 153-178 Agren H; Gel'mukhanov F Kramers-Heisenberg and Weisskopf-Wigner descriptions of resonant X-ray Raman scattering | 0 | 2 |
| 5978 | 3 | 152 | 5813 2000 JOURNAL OF MODERN OPTICS 47 (11): 2029-2065 Bullough RK Special Foundation Lecture: a personal view | 0 | 4 |
| 5979 | 1 | 26 | 5815 2000 JOURNAL OF PHILOSOPHY 97 (5): 257-277 Tennant N Deductive versus expressive power: A pre-Godelian predicament | 0 | 0 |
| 5980 | 4 | 34 | 5817 2000 JOURNAL OF PHYSICAL CHEMISTRY A 104 (25): 5937-5941 Harrison BC; Seminario JM; Bunz UHF; Myrick ML Lowest electronic excited states of poly (para-cyclobutadienylenecyclopentadienylcobalt)butadiynylene | 0 | 0 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5981 | 1 | 22 | 5818 2000 JOURNAL OF PHYSICAL CHEMISTRY A 104 (45): 10409-10413 Grebenshchikov SY Bi-orthogonality of resonance wave functions in NO2 | 0 | 4 |
| 5982 | 1 | 20 | 5820 2000 JOURNAL OF PHYSICS A-MATHEMATICAL AND GENERAL 33 (13): L133-L139 Young AJ; McComb WD Effective viscosity due to local turbulence interactions near the cutoff wavenumber in a constrained numerical simulation | 0 | 1 |
| 5983 | 1 | 25 | 5821 2000 JOURNAL OF PHYSICS A-MATHEMATICAL AND GENERAL 33 (22): 4009-4014 Wang YS The reconstruction of local quantum operators for the boundary XXZ spin-1/2 Heisenberg chain | 0 | 2 |
| 5984 | 1 | 59 | 5822 2000 JOURNAL OF PHYSICS A-MATHEMATICAL AND GENERAL 33 (29): 5231-5266 Schroer B New concepts in particle physics from the solution of an old problem | 0 | 0 |
| 5985 | 2 | 25 | 5824 2000 JOURNAL OF PHYSICS A-MATHEMATICAL AND GENERAL 33 (45): 8081-8103 Czachor M Non-canonical quantum optics | 0 | 2 |
| 5986 | 3 | 25 | 5825 2000 JOURNAL OF PHYSICS B-ATOMIC MOLECULAR AND OPTICAL PHYSICS 33 (18): 3583-3604 Heim TA; Hencken K; Trautmann D; Baur G Coherent and incoherent atomic scattering: formalism and application to pionium interacting with matter | 0 | 6 |
| 5987 | 5 | 37 | 5829 2000 LIQUID CRYSTALS 27 (2): 269-276 Dash SK; Singh RK; Alapati PR; Verma AL Pre-resonance Raman studies of some mesogens - TB4A, TB7A and TB10A | 0 | 1 |
| 5988 | 2 | 22 | 5831 2000 MODERN PHYSICS LETTERS A 15 (19): 1227-1235 Cvetic G; Yu JY Borel-Pade vs Borel-Weniger method: A QED and a QCD example | 0 | 3 |
| 5989 | 2 | 46 | 5833 2000 NUCLEAR PHYSICS B 567 (3): 554-582 Kitanine N; Maillet JM; Terras V Correlation functions of the XXZ Heisenberg spin-1/2 chain in a magnetic field | 0 | 33 |
| 5990 | 1 | 32 | 5835 2000 NUOVO CIMENTO DELLA SOCIETA ITALIANA DI FISICA B-GENERAL PHYSICS RELATIVITY ASTRONOMY AND MATHEMATICAL PHYSICS AND METHODS 115 (7-9): 687-692 Zerilli FJ Gravitational and electromagnetic radiation around black holes | 0 | 0 |
| # | LCR | NCR | Nodes / Date / Journal / Authors | LCS | GCS |
| 5991 | 4 | 25 | 5836 2000 NUOVO CIMENTO DELLA SOCIETA ITALIANA DI FISICA B-GENERAL PHYSICS RELATIVITY ASTRONOMY AND MATHEMATICAL PHYSICS AND METHODS 115 (7-9): 761-774 Khriplovich IB Charged-particle creation by charged black holes | 0 | 0 |
| 5992 | 2 | 15 | 5837 2000 NUOVO CIMENTO DELLA SOCIETA ITALIANA DI FISICA C-GEOPHYSICS AND SPACE PHYSICS 23 (5): 453-468 Moraes OLL; Acevedo OC A new theoretical model for the spectra of turbulent kinetic energy which includes a proposal for the divergence of spectral energy | 0 | 0 |
| 5993 | 1 | 14 | 5838 2000 OPTICS AND SPECTROSCOPY 88 (3): 365-367 Khoperskii AN; Yavna VA; Nadolinskii AM; Timoshevskaya VV Orientation effects in anomalous elastic scattering of polarized X-rays by a linear molecule | 0 | 0 |
| 5994 | 2 | 23 | 5840 2000 OPTICS COMMUNICATIONS 179 (1-6): 247-256 Stenholm S How to see a ghost | 0 | 1 |
| 5995 | 6 | 50 | 5841 2000 OPTICS COMMUNICATIONS 179 (1-6): 337-355 Englert BG; Bergou JA Quantitative quantum erasure | 0 | 17 |
| 5996 | 1 | 45 | 5842 2000 PHILOSOPHICAL TRANSACTIONS OF THE ROYAL SOCIETY OF LONDON SERIES A- MATHEMATICAL PHYSICAL AND ENGINEERING SCIENCES 358 (1765): 245-260 Bowles RI Transition to turbulent flow in aerodynamics | 0 | 3 |
| 5997 | 4 | 26 | 5844 2000 PHYSICAL REVIEW A 61 (5): Art. No. 052105 Hai WH; Feng M; Zhu XW; Shi L; Gao KL; et al. Alternative quantum perturbation theory without divergences | 0 | 11 |
| 5998 | 3 | 47 | 5845 2000 PHYSICAL REVIEW A 62 (1): Art. No. 012712 Carminati R; Saenz JJ; Greffet JJ; Nieto-Vesperinas M Reciprocity, unitarity, and time-reversal symmetry of the S matrix of fields containing evanescent components | 0 | 7 |
| 5999 | 5 | 43 | 5846 2000 PHYSICAL REVIEW A 62 (3): art. no.-32106 Tsegaye T; Bjork G; Atature M; Sergienko AV; Saleh BEA; et al. Complementarity and quantum erasure with entangled-photon states | 0 | 10 |
| 6000 | 2 | 16 | 5847 2000 PHYSICAL REVIEW A 6102 (2): Art. No. 022311 Rubin MH Entanglement and state preparation | 0 | 3 |
Page 20: 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23
Generated by: HistCite 2005.04.07